C17H19N5O — CID 82271352
4-methyl-5-piperidin-4-yl-2-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 82271352) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-methyl-5-piperidin-4-yl-2-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 4-methyl-5-piperidin-4-yl-2-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 82271352 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-methyl-5-piperidin-4-yl-2-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cn1c(C2CCNCC2)cc(=O)n2nc(-c3cccnc3)cc12 |
| InChI | InChI=1S/C17H19N5O/c1-21-15(12-4-7-18-8-5-12)10-17(23)22-16(21)9-14(20-22)13-3-2-6-19-11-13/h2-3,6,9-12,18H,4-5,7-8H2,1H3 |
| InChIKey | NKVDHRLAUXNYMM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|