C16H13ClFN3 — CID 82274863
2-chloro-10-(2-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 82274863) has the molecular formula C16H13ClFN3 and a molecular weight of 301.75 g/mol. Its IUPAC name is 2-chloro-10-(2-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 2-chloro-10-(2-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 82274863 |
| Molecular Formula | C16H13ClFN3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-chloro-10-(2-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | Cc1nn2c(Cl)c3c(nc2c1-c1ccccc1F)CCC3 |
| InChI | InChI=1S/C16H13ClFN3/c1-9-14(10-5-2-3-7-12(10)18)16-19-13-8-4-6-11(13)15(17)21(16)20-9/h2-3,5,7H,4,6,8H2,1H3 |
| InChIKey | MIWMKUWEAOWSDA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |