C12H15NO3 — CID 82276318
6,7-dimethoxy-1-methyl-2,3-dihydroquinolin-4-one (PubChem CID 82276318) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 6,7-dimethoxy-1-methyl-2,3-dihydroquinolin-4-one.
| Compound Name | 6,7-dimethoxy-1-methyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 82276318 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 6,7-dimethoxy-1-methyl-2,3-dihydroquinolin-4-one |
| SMILES | COc1cc2c(cc1OC)N(C)CCC2=O |
| InChI | InChI=1S/C12H15NO3/c1-13-5-4-10(14)8-6-11(15-2)12(16-3)7-9(8)13/h6-7H,4-5H2,1-3H3 |
| InChIKey | SJADTBAZBSRDMW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|