C8H10N4S — CID 82281804
2-(3-thiophen-2-yl-1,2,4-triazol-1-yl)ethanamine (PubChem CID 82281804) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-(3-thiophen-2-yl-1,2,4-triazol-1-yl)ethanamine.
| Compound Name | 2-(3-thiophen-2-yl-1,2,4-triazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 82281804 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-(3-thiophen-2-yl-1,2,4-triazol-1-yl)ethanamine |
| SMILES | NCCn1cnc(-c2cccs2)n1 |
| InChI | InChI=1S/C8H10N4S/c9-3-4-12-6-10-8(11-12)7-2-1-5-13-7/h1-2,5-6H,3-4,9H2 |
| InChIKey | GEJTZWLCEAUPCW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |