C16H17NO — CID 82292503
methyl 4-(2,3-dimethylphenyl)benzenecarboximidate (PubChem CID 82292503) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is methyl 4-(2,3-dimethylphenyl)benzenecarboximidate.
| Compound Name | methyl 4-(2,3-dimethylphenyl)benzenecarboximidate |
|---|---|
| PubChem CID | 82292503 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | methyl 4-(2,3-dimethylphenyl)benzenecarboximidate |
| SMILES | [H]/N=C(\OC)c1ccc(-c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C16H17NO/c1-11-5-4-6-15(12(11)2)13-7-9-14(10-8-13)16(17)18-3/h4-10,17H,1-3H3/b17-16- |
| InChIKey | QWPJCVSBMUFSND-MSUUIHNZSA-N |
| XLogP | 3.94 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|