C15H19NO5 — CID 82321079
3-[2-carboxyethyl(2,2-dimethylpropanoyl)amino]benzoic acid (PubChem CID 82321079) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-[2-carboxyethyl(2,2-dimethylpropanoyl)amino]benzoic acid.
| Compound Name | 3-[2-carboxyethyl(2,2-dimethylpropanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 82321079 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-[2-carboxyethyl(2,2-dimethylpropanoyl)amino]benzoic acid |
| SMILES | CC(C)(C)C(=O)N(CCC(=O)O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H19NO5/c1-15(2,3)14(21)16(8-7-12(17)18)11-6-4-5-10(9-11)13(19)20/h4-6,9H,7-8H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | RBWGMYGSJXPNLM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |