C15H14ClN3 — CID 82343065
5-chloro-2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridin-8-amine (PubChem CID 82343065) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 5-chloro-2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridin-8-amine.
| Compound Name | 5-chloro-2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 82343065 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 5-chloro-2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridin-8-amine |
| SMILES | Cc1ccc(-c2cn3c(Cl)ccc(N)c3n2)cc1C |
| InChI | InChI=1S/C15H14ClN3/c1-9-3-4-11(7-10(9)2)13-8-19-14(16)6-5-12(17)15(19)18-13/h3-8H,17H2,1-2H3 |
| InChIKey | RLICRXKMUREOGF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|