C13H17NO3 — CID 82350295
2-[(4-ethoxy-3-methoxyphenyl)methyl]-3-hydroxypropanenitrile (PubChem CID 82350295) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-methoxyphenyl)methyl]-3-hydroxypropanenitrile.
| Compound Name | 2-[(4-ethoxy-3-methoxyphenyl)methyl]-3-hydroxypropanenitrile |
|---|---|
| PubChem CID | 82350295 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-[(4-ethoxy-3-methoxyphenyl)methyl]-3-hydroxypropanenitrile |
| SMILES | CCOc1ccc(CC(C#N)CO)cc1OC |
| InChI | InChI=1S/C13H17NO3/c1-3-17-12-5-4-10(7-13(12)16-2)6-11(8-14)9-15/h4-5,7,11,15H,3,6,9H2,1-2H3 |
| InChIKey | SRBYMGUNVKCUGE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |