About 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide
2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide (PubChem CID 82358419) has the molecular formula C8H11N5O2
and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide.
Molecular Properties
| Compound Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide |
| PubChem CID | 82358419 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide |
| SMILES | CN(CCC#N)C(=O)Cc1nonc1N |
| InChI | InChI=1S/C8H11N5O2/c1-13(4-2-3-9)7(14)5-6-8(10)12-15-11-6/h2,4-5H2,1H3,(H2,10,12) |
| InChIKey | SRIYDPNJEFOPFQ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide?
The IUPAC name of 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide (CID 82358419) is 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide.
What is the SMILES notation for 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide?
The canonical SMILES for 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide is CN(CCC#N)C(=O)Cc1nonc1N.
What is the InChIKey of 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide?
The InChIKey is SRIYDPNJEFOPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O2/c1-13(4-2-3-9)7(14)5-6-8(10)12-15-11-6/h2,4-5H2,1H3,(H2,10,12).
What are the key properties of 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide?
2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide has a molecular weight of 209.21 g/mol, XLogP of -0.43, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(2-cyanoethyl)-N-methylacetamide is sourced from PubChem (CID 82358419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).