C8H16N2O — CID 82358806
[1-(methoxymethyl)-3,6-dihydro-2H-pyridin-6-yl]methanamine (PubChem CID 82358806) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is [1-(methoxymethyl)-3,6-dihydro-2H-pyridin-6-yl]methanamine.
| Compound Name | [1-(methoxymethyl)-3,6-dihydro-2H-pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 82358806 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | [1-(methoxymethyl)-3,6-dihydro-2H-pyridin-6-yl]methanamine |
| SMILES | COCN1CCC=CC1CN |
| InChI | InChI=1S/C8H16N2O/c1-11-7-10-5-3-2-4-8(10)6-9/h2,4,8H,3,5-7,9H2,1H3 |
| InChIKey | PNRRTOLETCNZOJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|