C12H14ClN3O — CID 82363804
6-chloro-3-piperazin-1-yl-2H-1,4-benzoxazine (PubChem CID 82363804) has the molecular formula C12H14ClN3O and a molecular weight of 251.72 g/mol. Its IUPAC name is 6-chloro-3-piperazin-1-yl-2H-1,4-benzoxazine.
| Compound Name | 6-chloro-3-piperazin-1-yl-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 82363804 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 6-chloro-3-piperazin-1-yl-2H-1,4-benzoxazine |
| SMILES | Clc1ccc2c(c1)N=C(N1CCNCC1)CO2 |
| InChI | InChI=1S/C12H14ClN3O/c13-9-1-2-11-10(7-9)15-12(8-17-11)16-5-3-14-4-6-16/h1-2,7,14H,3-6,8H2 |
| InChIKey | LBRXNJZCIGAXBL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |