C13H17N3O — CID 176764050
4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine (PubChem CID 176764050) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine.
| Compound Name | 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine |
|---|---|
| PubChem CID | 176764050 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine |
| SMILES | c1ccc2c(c1)N=C(N1CCNCC1)CCO2 |
| InChI | InChI=1S/C13H17N3O/c1-2-4-12-11(3-1)15-13(5-10-17-12)16-8-6-14-7-9-16/h1-4,14H,5-10H2 |
| InChIKey | ZPBXTYBJTWUZOQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |