About 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine
4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine (PubChem CID 176764050) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine |
| PubChem CID | 176764050 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine |
| SMILES | c1ccc2c(c1)N=C(N1CCNCC1)CCO2 |
| InChI | InChI=1S/C13H17N3O/c1-2-4-12-11(3-1)15-13(5-10-17-12)16-8-6-14-7-9-16/h1-4,14H,5-10H2 |
| InChIKey | ZPBXTYBJTWUZOQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine?
The IUPAC name of 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine (CID 176764050) is 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine.
What is the SMILES notation for 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine?
The canonical SMILES for 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine is c1ccc2c(c1)N=C(N1CCNCC1)CCO2.
What is the InChIKey of 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine?
The InChIKey is ZPBXTYBJTWUZOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c1-2-4-12-11(3-1)15-13(5-10-17-12)16-8-6-14-7-9-16/h1-4,14H,5-10H2.
What are the key properties of 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine?
4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine has a molecular weight of 231.30 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-2,3-dihydro-1,5-benzoxazepine is sourced from PubChem (CID 176764050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).