C13H18N2 — CID 82364080
[4-(3,6-dihydro-2H-pyridin-1-ylmethyl)phenyl]methanamine (PubChem CID 82364080) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is [4-(3,6-dihydro-2H-pyridin-1-ylmethyl)phenyl]methanamine.
| Compound Name | [4-(3,6-dihydro-2H-pyridin-1-ylmethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 82364080 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | [4-(3,6-dihydro-2H-pyridin-1-ylmethyl)phenyl]methanamine |
| SMILES | NCc1ccc(CN2CC=CCC2)cc1 |
| InChI | InChI=1S/C13H18N2/c14-10-12-4-6-13(7-5-12)11-15-8-2-1-3-9-15/h1-2,4-7H,3,8-11,14H2 |
| InChIKey | HUZCMHBLPFCSSV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|