C15H17N5O2 — CID 82365205
benzyl 2-[5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl]acetate (PubChem CID 82365205) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is benzyl 2-[5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl]acetate.
| Compound Name | benzyl 2-[5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl]acetate |
|---|---|
| PubChem CID | 82365205 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | benzyl 2-[5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl]acetate |
| SMILES | O=C(CN1CCC=C(c2nn[nH]n2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C15H17N5O2/c21-14(22-11-12-5-2-1-3-6-12)10-20-8-4-7-13(9-20)15-16-18-19-17-15/h1-3,5-7H,4,8-11H2,(H,16,17,18,19) |
| InChIKey | DCIZNLWCNQGQFG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |