C11H14N4O2 — CID 82371988
(Z)-5-(4-aminoimidazo[4,5-c]pyridin-1-yl)pent-3-ene-1,2-diol (PubChem CID 82371988) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is (Z)-5-(4-aminoimidazo[4,5-c]pyridin-1-yl)pent-3-ene-1,2-diol.
| Compound Name | (Z)-5-(4-aminoimidazo[4,5-c]pyridin-1-yl)pent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 82371988 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (Z)-5-(4-aminoimidazo[4,5-c]pyridin-1-yl)pent-3-ene-1,2-diol |
| SMILES | Nc1nccc2c1ncn2C/C=C\C(O)CO |
| InChI | InChI=1S/C11H14N4O2/c12-11-10-9(3-4-13-11)15(7-14-10)5-1-2-8(17)6-16/h1-4,7-8,16-17H,5-6H2,(H2,12,13)/b2-1- |
| InChIKey | XRBAWOBXAHMXLX-UPHRSURJSA-N |
| XLogP | -0.08 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|