C10H10ClNO4S — CID 82372083
2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-8-sulfonyl chloride (PubChem CID 82372083) has the molecular formula C10H10ClNO4S and a molecular weight of 275.71 g/mol. Its IUPAC name is 2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-8-sulfonyl chloride.
| Compound Name | 2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-8-sulfonyl chloride |
|---|---|
| PubChem CID | 82372083 |
| Molecular Formula | C10H10ClNO4S |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-8-sulfonyl chloride |
| SMILES | Cc1cc2c(c(S(=O)(=O)Cl)c1)OC(C)C(=O)N2 |
| InChI | InChI=1S/C10H10ClNO4S/c1-5-3-7-9(8(4-5)17(11,14)15)16-6(2)10(13)12-7/h3-4,6H,1-2H3,(H,12,13) |
| InChIKey | JWKPGVQFPVXBCO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |