5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid

C7H5N3O3 — CID 82373194

IUPAC5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid
SMILESCc1ncc2onc(C(=O)O)c2n1
InChIInChI=1S/C7H5N3O3/c1-3-8-2-4-5(9-3)6(7(11)12)10-13-4/h2H,1H3,(H,11,12)
InChIKeyHBUYUKPILYJDEM-UHFFFAOYSA-N
MW179.13 g/mol
LogP0.62
Rot. Bonds1

About 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid

5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid (PubChem CID 82373194) has the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. Its IUPAC name is 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid.

Molecular Properties

Compound Name5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid
PubChem CID82373194
Molecular FormulaC7H5N3O3
Molecular Weight179.13 g/mol
Exact Mass179.03
IUPAC Name5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid
SMILESCc1ncc2onc(C(=O)O)c2n1
InChIInChI=1S/C7H5N3O3/c1-3-8-2-4-5(9-3)6(7(11)12)10-13-4/h2H,1H3,(H,11,12)
InChIKeyHBUYUKPILYJDEM-UHFFFAOYSA-N
XLogP0.62
TPSA89.11 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.13
LogP ≤ 50.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid?
The IUPAC name of 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid (CID 82373194) is 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid.
What is the SMILES notation for 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid?
The canonical SMILES for 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid is Cc1ncc2onc(C(=O)O)c2n1.
What is the InChIKey of 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid?
The InChIKey is HBUYUKPILYJDEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O3/c1-3-8-2-4-5(9-3)6(7(11)12)10-13-4/h2H,1H3,(H,11,12).
What are the key properties of 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid?
5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid has a molecular weight of 179.13 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid is sourced from PubChem (CID 82373194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).