C12H11ClFNO2S — CID 82375202
4-[(4-fluoro-3-methylphenyl)methyl]-1H-pyrrole-2-sulfonyl chloride (PubChem CID 82375202) has the molecular formula C12H11ClFNO2S and a molecular weight of 287.74 g/mol. Its IUPAC name is 4-[(4-fluoro-3-methylphenyl)methyl]-1H-pyrrole-2-sulfonyl chloride.
| Compound Name | 4-[(4-fluoro-3-methylphenyl)methyl]-1H-pyrrole-2-sulfonyl chloride |
|---|---|
| PubChem CID | 82375202 |
| Molecular Formula | C12H11ClFNO2S |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-[(4-fluoro-3-methylphenyl)methyl]-1H-pyrrole-2-sulfonyl chloride |
| SMILES | Cc1cc(Cc2c[nH]c(S(=O)(=O)Cl)c2)ccc1F |
| InChI | InChI=1S/C12H11ClFNO2S/c1-8-4-9(2-3-11(8)14)5-10-6-12(15-7-10)18(13,16)17/h2-4,6-7,15H,5H2,1H3 |
| InChIKey | WDLIYOULBHCAFK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |