C13H12N2O2 — CID 82377284
2-(2-methylphenyl)-2,4-dihydro-1H-furo[2,3-b]pyrazin-3-one (PubChem CID 82377284) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-(2-methylphenyl)-2,4-dihydro-1H-furo[2,3-b]pyrazin-3-one.
| Compound Name | 2-(2-methylphenyl)-2,4-dihydro-1H-furo[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 82377284 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(2-methylphenyl)-2,4-dihydro-1H-furo[2,3-b]pyrazin-3-one |
| SMILES | Cc1ccccc1C1Nc2ccoc2NC1=O |
| InChI | InChI=1S/C13H12N2O2/c1-8-4-2-3-5-9(8)11-12(16)15-13-10(14-11)6-7-17-13/h2-7,11,14H,1H3,(H,15,16) |
| InChIKey | LWHZQJFQCQAIQQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |