C12H17NOS — CID 82391933
5-(2-aminoethyl)-2,3,4,5-tetrahydro-1-benzothiepin-7-ol (PubChem CID 82391933) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 5-(2-aminoethyl)-2,3,4,5-tetrahydro-1-benzothiepin-7-ol.
| Compound Name | 5-(2-aminoethyl)-2,3,4,5-tetrahydro-1-benzothiepin-7-ol |
|---|---|
| PubChem CID | 82391933 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5-(2-aminoethyl)-2,3,4,5-tetrahydro-1-benzothiepin-7-ol |
| SMILES | NCCC1CCCSc2ccc(O)cc21 |
| InChI | InChI=1S/C12H17NOS/c13-6-5-9-2-1-7-15-12-4-3-10(14)8-11(9)12/h3-4,8-9,14H,1-2,5-7,13H2 |
| InChIKey | MKZFOZAARJGGGB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |