About 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one
3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one (PubChem CID 82413363) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one.
Analyze 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one?
The IUPAC name of 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one (CID 82413363) is 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one.
What is the SMILES notation for 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one?
The canonical SMILES for 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one is Cc1nc(C(=O)CCN)oc1C.
What is the InChIKey of 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one?
The InChIKey is BWYUYCGSXPWNOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5-6(2)12-8(10-5)7(11)3-4-9/h3-4,9H2,1-2H3.
What are the key properties of 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one?
3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one has a molecular weight of 168.20 g/mol, XLogP of 0.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(4,5-dimethyl-1,3-oxazol-2-yl)propan-1-one is sourced from PubChem (CID 82413363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).