About 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one
3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one (PubChem CID 84763473) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one |
| PubChem CID | 84763473 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one |
| SMILES | Cc1cnoc1C(=O)CCN |
| InChI | InChI=1S/C7H10N2O2/c1-5-4-9-11-7(5)6(10)2-3-8/h4H,2-3,8H2,1H3 |
| InChIKey | KFZXSMIEJQMBEW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one?
The IUPAC name of 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one (CID 84763473) is 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one.
What is the SMILES notation for 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one?
The canonical SMILES for 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one is Cc1cnoc1C(=O)CCN.
What is the InChIKey of 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one?
The InChIKey is KFZXSMIEJQMBEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5-4-9-11-7(5)6(10)2-3-8/h4H,2-3,8H2,1H3.
What are the key properties of 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one?
3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one has a molecular weight of 154.17 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one is sourced from PubChem (CID 84763473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).