C7H10N2O2 — CID 84763473
3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one (PubChem CID 84763473) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one.
| Compound Name | 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 84763473 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3-amino-1-(4-methyl-1,2-oxazol-5-yl)propan-1-one |
| SMILES | Cc1cnoc1C(=O)CCN |
| InChI | InChI=1S/C7H10N2O2/c1-5-4-9-11-7(5)6(10)2-3-8/h4H,2-3,8H2,1H3 |
| InChIKey | KFZXSMIEJQMBEW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |