About 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one
5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one (PubChem CID 82414345) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one.
Analyze 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one?
The IUPAC name of 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one (CID 82414345) is 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one.
What is the SMILES notation for 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one?
The canonical SMILES for 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one is O=c1[nH]oc2c1C1CCC(C2)N1.
What is the InChIKey of 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one?
The InChIKey is SVDUDLLDQLKCQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c11-8-7-5-2-1-4(9-5)3-6(7)12-10-8/h4-5,9H,1-3H2,(H,10,11).
What are the key properties of 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one?
5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one has a molecular weight of 166.18 g/mol, XLogP of 0.32, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxa-4,11-diazatricyclo[6.2.1.02,6]undec-2(6)-en-3-one is sourced from PubChem (CID 82414345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).