C6H3ClN2O — CID 82416459
4-chloro-[1,2]oxazolo[5,4-b]pyridine (PubChem CID 82416459) has the molecular formula C6H3ClN2O and a molecular weight of 154.56 g/mol. Its IUPAC name is 4-chloro-[1,2]oxazolo[5,4-b]pyridine.
| Compound Name | 4-chloro-[1,2]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 82416459 |
| Molecular Formula | C6H3ClN2O |
| Molecular Weight | 154.56 g/mol |
| Exact Mass | 153.99 |
| IUPAC Name | 4-chloro-[1,2]oxazolo[5,4-b]pyridine |
| SMILES | Clc1ccnc2oncc12 |
| InChI | InChI=1S/C6H3ClN2O/c7-5-1-2-8-6-4(5)3-9-10-6/h1-3H |
| InChIKey | IKYSYKPDFCZSHP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |