C9H18N2 — CID 82416479
1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-6-amine (PubChem CID 82416479) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-6-amine.
| Compound Name | 1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-6-amine |
|---|---|
| PubChem CID | 82416479 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-6-amine |
| SMILES | CN1CCC2CCC(N)CC21 |
| InChI | InChI=1S/C9H18N2/c1-11-5-4-7-2-3-8(10)6-9(7)11/h7-9H,2-6,10H2,1H3 |
| InChIKey | HJEHGRQTGRDPAZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |