C14H30N2S — CID 165121239
ethane;N-[(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl)sulfanyl]propan-2-amine (PubChem CID 165121239) has the molecular formula C14H30N2S and a molecular weight of 258.47 g/mol. Its IUPAC name is ethane;N-[(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl)sulfanyl]propan-2-amine.
| Compound Name | ethane;N-[(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl)sulfanyl]propan-2-amine |
|---|---|
| PubChem CID | 165121239 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | ethane;N-[(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl)sulfanyl]propan-2-amine |
| SMILES | CC.CC(C)NSC1CCC2CCN(C)C2C1 |
| InChI | InChI=1S/C12H24N2S.C2H6/c1-9(2)13-15-11-5-4-10-6-7-14(3)12(10)8-11;1-2/h9-13H,4-8H2,1-3H3;1-2H3 |
| InChIKey | GGIAOAZPURZJRG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|