About 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine
6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine (PubChem CID 82417454) has the molecular formula C7H10N4
and a molecular weight of 150.19 g/mol. Its IUPAC name is 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine.
Analyze 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine (CID 82417454) is 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine is CN1Cc2ncnc(N)c2C1.
What is the InChIKey of 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine?
The InChIKey is PVRLCWOARFDLRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4/c1-11-2-5-6(3-11)9-4-10-7(5)8/h4H,2-3H2,1H3,(H2,8,9,10).
What are the key properties of 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine?
6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine has a molecular weight of 150.19 g/mol, XLogP of 0.00, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 82417454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).