C5H6IN5 — CID 150783600
2-iodo-1,3-dihydropyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 150783600) has the molecular formula C5H6IN5 and a molecular weight of 263.04 g/mol. Its IUPAC name is 2-iodo-1,3-dihydropyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-iodo-1,3-dihydropyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 150783600 |
| Molecular Formula | C5H6IN5 |
| Molecular Weight | 263.04 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 2-iodo-1,3-dihydropyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1CN(I)N2 |
| InChI | InChI=1S/C5H6IN5/c6-11-1-3-4(7)8-2-9-5(3)10-11/h2H,1H2,(H3,7,8,9,10) |
| InChIKey | KCJYFSQZVNZWAC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.04 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|