C6H7N5 — CID 123187409
5,8-dihydropyrimido[4,5-d]pyridazin-4-amine (PubChem CID 123187409) has the molecular formula C6H7N5 and a molecular weight of 149.16 g/mol. Its IUPAC name is 5,8-dihydropyrimido[4,5-d]pyridazin-4-amine.
| Compound Name | 5,8-dihydropyrimido[4,5-d]pyridazin-4-amine |
|---|---|
| PubChem CID | 123187409 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 5,8-dihydropyrimido[4,5-d]pyridazin-4-amine |
| SMILES | Nc1ncnc2c1CN=NC2 |
| InChI | InChI=1S/C6H7N5/c7-6-4-1-10-11-2-5(4)8-3-9-6/h3H,1-2H2,(H2,7,8,9) |
| InChIKey | QXMKZUCMGDMJBY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |