C12H9N3O2S2 — CID 82424186
5-[2-(2-methoxyphenyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82424186) has the molecular formula C12H9N3O2S2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 5-[2-(2-methoxyphenyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(2-methoxyphenyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82424186 |
| Molecular Formula | C12H9N3O2S2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 5-[2-(2-methoxyphenyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccccc1-c1ncc(-c2n[nH]c(=S)o2)s1 |
| InChI | InChI=1S/C12H9N3O2S2/c1-16-8-5-3-2-4-7(8)11-13-6-9(19-11)10-14-15-12(18)17-10/h2-6H,1H3,(H,15,18) |
| InChIKey | NIHGHHBGFQEXFI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|