C13H12N4O2S — CID 82527988
5-[1-(2-methoxyphenyl)-5-methylpyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82527988) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 5-[1-(2-methoxyphenyl)-5-methylpyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[1-(2-methoxyphenyl)-5-methylpyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82527988 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-[1-(2-methoxyphenyl)-5-methylpyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccccc1-n1ncc(-c2n[nH]c(=S)o2)c1C |
| InChI | InChI=1S/C13H12N4O2S/c1-8-9(12-15-16-13(20)19-12)7-14-17(8)10-5-3-4-6-11(10)18-2/h3-7H,1-2H3,(H,16,20) |
| InChIKey | BYNAISAJHMLXKY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|