C13H12N4S2 — CID 82425474
5-[2-(2-phenylethyl)-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82425474) has the molecular formula C13H12N4S2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 5-[2-(2-phenylethyl)-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[2-(2-phenylethyl)-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82425474 |
| Molecular Formula | C13H12N4S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 5-[2-(2-phenylethyl)-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2cnc(CCc3ccccc3)s2)[nH][nH]1 |
| InChI | InChI=1S/C13H12N4S2/c18-13-15-12(16-17-13)10-8-14-11(19-10)7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,15,16,17,18) |
| InChIKey | WKXJLOKTNJJNAU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|