C10H12N4OS2 — CID 82427880
5-(4-methyl-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82427880) has the molecular formula C10H12N4OS2 and a molecular weight of 268.37 g/mol. Its IUPAC name is 5-(4-methyl-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(4-methyl-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82427880 |
| Molecular Formula | C10H12N4OS2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-(4-methyl-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1nc(N2CCCC2)sc1-c1n[nH]c(=S)o1 |
| InChI | InChI=1S/C10H12N4OS2/c1-6-7(8-12-13-10(16)15-8)17-9(11-6)14-4-2-3-5-14/h2-5H2,1H3,(H,13,16) |
| InChIKey | QGAQJNQIJLDQIR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|