C11H14N4OS2 — CID 82514809
5-[2-(azepan-1-yl)-1,3-thiazol-4-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82514809) has the molecular formula C11H14N4OS2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 5-[2-(azepan-1-yl)-1,3-thiazol-4-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(azepan-1-yl)-1,3-thiazol-4-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82514809 |
| Molecular Formula | C11H14N4OS2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-[2-(azepan-1-yl)-1,3-thiazol-4-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2csc(N3CCCCCC3)n2)o1 |
| InChI | InChI=1S/C11H14N4OS2/c17-11-14-13-9(16-11)8-7-18-10(12-8)15-5-3-1-2-4-6-15/h7H,1-6H2,(H,14,17) |
| InChIKey | CZAOHAJVWQUBRZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|