C12H16N4S2 — CID 82436172
3-(4-cyclopropyl-2-propyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 82436172) has the molecular formula C12H16N4S2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 3-(4-cyclopropyl-2-propyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-cyclopropyl-2-propyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82436172 |
| Molecular Formula | C12H16N4S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3-(4-cyclopropyl-2-propyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1nc(C2CC2)c(-c2n[nH]c(=S)n2C)s1 |
| InChI | InChI=1S/C12H16N4S2/c1-3-4-8-13-9(7-5-6-7)10(18-8)11-14-15-12(17)16(11)2/h7H,3-6H2,1-2H3,(H,15,17) |
| InChIKey | UBZBVJIJEWJLEL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|