C13H18N4S2 — CID 82436982
3-(2-tert-butyl-4-cyclopropyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 82436982) has the molecular formula C13H18N4S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 3-(2-tert-butyl-4-cyclopropyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-tert-butyl-4-cyclopropyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82436982 |
| Molecular Formula | C13H18N4S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-(2-tert-butyl-4-cyclopropyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(-c2sc(C(C)(C)C)nc2C2CC2)n[nH]c1=S |
| InChI | InChI=1S/C13H18N4S2/c1-13(2,3)11-14-8(7-5-6-7)9(19-11)10-15-16-12(18)17(10)4/h7H,5-6H2,1-4H3,(H,16,18) |
| InChIKey | UHQHUWDOKJPQLN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|