C12H19N5S2 — CID 82439622
3-[4-tert-butyl-2-(dimethylamino)-1,3-thiazol-5-yl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 82439622) has the molecular formula C12H19N5S2 and a molecular weight of 297.45 g/mol. Its IUPAC name is 3-[4-tert-butyl-2-(dimethylamino)-1,3-thiazol-5-yl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-tert-butyl-2-(dimethylamino)-1,3-thiazol-5-yl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82439622 |
| Molecular Formula | C12H19N5S2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-[4-tert-butyl-2-(dimethylamino)-1,3-thiazol-5-yl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | CN(C)c1nc(C(C)(C)C)c(-c2n[nH]c(=S)n2C)s1 |
| InChI | InChI=1S/C12H19N5S2/c1-12(2,3)8-7(19-11(13-8)16(4)5)9-14-15-10(18)17(9)6/h1-6H3,(H,15,18) |
| InChIKey | TVDLCNYJDYLJAK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|