C11H16BrNS2 — CID 82436791
5-(bromomethyl)-4-cyclopropyl-2-(propylsulfanylmethyl)-1,3-thiazole (PubChem CID 82436791) has the molecular formula C11H16BrNS2 and a molecular weight of 306.29 g/mol. Its IUPAC name is 5-(bromomethyl)-4-cyclopropyl-2-(propylsulfanylmethyl)-1,3-thiazole.
| Compound Name | 5-(bromomethyl)-4-cyclopropyl-2-(propylsulfanylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 82436791 |
| Molecular Formula | C11H16BrNS2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 5-(bromomethyl)-4-cyclopropyl-2-(propylsulfanylmethyl)-1,3-thiazole |
| SMILES | CCCSCc1nc(C2CC2)c(CBr)s1 |
| InChI | InChI=1S/C11H16BrNS2/c1-2-5-14-7-10-13-11(8-3-4-8)9(6-12)15-10/h8H,2-7H2,1H3 |
| InChIKey | RAYSPLLKBCXRTD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|