About 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine
1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine (PubChem CID 82437535) has the molecular formula C10H15BrN2S
and a molecular weight of 275.21 g/mol. Its IUPAC name is 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine |
| PubChem CID | 82437535 |
| Molecular Formula | C10H15BrN2S |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1nc(C2CC2)c(CBr)s1 |
| InChI | InChI=1S/C10H15BrN2S/c1-13(2)6-9-12-10(7-3-4-7)8(5-11)14-9/h7H,3-6H2,1-2H3 |
| InChIKey | QRJAKOAPOXMBDB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine (CID 82437535) is 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine is CN(C)Cc1nc(C2CC2)c(CBr)s1.
What is the InChIKey of 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine?
The InChIKey is QRJAKOAPOXMBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrN2S/c1-13(2)6-9-12-10(7-3-4-7)8(5-11)14-9/h7H,3-6H2,1-2H3.
What are the key properties of 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine?
1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine has a molecular weight of 275.21 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(bromomethyl)-4-cyclopropyl-1,3-thiazol-2-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 82437535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).