C14H13N5OS — CID 82445563
3-(2,4-dimethylphenyl)-5-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1H-pyridazin-6-one (PubChem CID 82445563) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-5-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1H-pyridazin-6-one.
| Compound Name | 3-(2,4-dimethylphenyl)-5-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 82445563 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-5-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1H-pyridazin-6-one |
| SMILES | Cc1ccc(-c2cc(-c3nc(=S)[nH][nH]3)c(=O)[nH]n2)c(C)c1 |
| InChI | InChI=1S/C14H13N5OS/c1-7-3-4-9(8(2)5-7)11-6-10(13(20)18-16-11)12-15-14(21)19-17-12/h3-6H,1-2H3,(H,18,20)(H2,15,17,19,21) |
| InChIKey | DRAWQGWEBRWBDZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|