C15H14N4OS — CID 82519961
6-(2,5-dimethylphenyl)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1H-pyridin-2-one (PubChem CID 82519961) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 6-(2,5-dimethylphenyl)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1H-pyridin-2-one.
| Compound Name | 6-(2,5-dimethylphenyl)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 82519961 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 6-(2,5-dimethylphenyl)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1H-pyridin-2-one |
| SMILES | Cc1ccc(C)c(-c2ccc(-c3nc(=S)[nH][nH]3)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C15H14N4OS/c1-8-3-4-9(2)11(7-8)12-6-5-10(14(20)16-12)13-17-15(21)19-18-13/h3-7H,1-2H3,(H,16,20)(H2,17,18,19,21) |
| InChIKey | HFEAACOLWYKKAE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|