C17H18N4S — CID 82449902
N-ethyl-5-(1,2,3,4-tetrahydroacridin-9-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 82449902) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is N-ethyl-5-(1,2,3,4-tetrahydroacridin-9-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-ethyl-5-(1,2,3,4-tetrahydroacridin-9-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82449902 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-ethyl-5-(1,2,3,4-tetrahydroacridin-9-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(-c2c3c(nc4ccccc24)CCCC3)s1 |
| InChI | InChI=1S/C17H18N4S/c1-2-18-17-21-20-16(22-17)15-11-7-3-5-9-13(11)19-14-10-6-4-8-12(14)15/h3,5,7,9H,2,4,6,8,10H2,1H3,(H,18,21) |
| InChIKey | NNBDOCQWBVLDFK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |