C14H15N3O3S — CID 82457476
6-(1,3-benzodioxol-5-ylmethylamino)-2-(methoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 82457476) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)-2-(methoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)-2-(methoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457476 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)-2-(methoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1nc(=S)cc(NCc2ccc3c(c2)OCO3)[nH]1 |
| InChI | InChI=1S/C14H15N3O3S/c1-18-7-13-16-12(5-14(21)17-13)15-6-9-2-3-10-11(4-9)20-8-19-10/h2-5H,6-8H2,1H3,(H2,15,16,17,21) |
| InChIKey | QBDISTVLZKRILS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|