C18H27NO3 — CID 82462644
N-butyl-6,6-diethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-amine (PubChem CID 82462644) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-butyl-6,6-diethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-amine.
| Compound Name | N-butyl-6,6-diethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-amine |
|---|---|
| PubChem CID | 82462644 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N-butyl-6,6-diethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-amine |
| SMILES | CCCCNC1CC(CC)(CC)Oc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H27NO3/c1-4-7-8-19-14-11-18(5-2,6-3)22-15-10-17-16(9-13(14)15)20-12-21-17/h9-10,14,19H,4-8,11-12H2,1-3H3 |
| InChIKey | YJNIRDDGPVSCRR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|