C13H19N5O2 — CID 82466531
3,7-diethyl-1-pyrrolidin-3-ylpurine-2,6-dione (PubChem CID 82466531) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 3,7-diethyl-1-pyrrolidin-3-ylpurine-2,6-dione.
| Compound Name | 3,7-diethyl-1-pyrrolidin-3-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 82466531 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3,7-diethyl-1-pyrrolidin-3-ylpurine-2,6-dione |
| SMILES | CCn1cnc2c1c(=O)n(C1CCNC1)c(=O)n2CC |
| InChI | InChI=1S/C13H19N5O2/c1-3-16-8-15-11-10(16)12(19)18(9-5-6-14-7-9)13(20)17(11)4-2/h8-9,14H,3-7H2,1-2H3 |
| InChIKey | DZEMAEVAVVFXSL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |