C20H30N4O3 — CID 54028870
3-cyclopropyl-1-hexyl-7-(3-oxohexyl)purine-2,6-dione (PubChem CID 54028870) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-cyclopropyl-1-hexyl-7-(3-oxohexyl)purine-2,6-dione.
| Compound Name | 3-cyclopropyl-1-hexyl-7-(3-oxohexyl)purine-2,6-dione |
|---|---|
| PubChem CID | 54028870 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 3-cyclopropyl-1-hexyl-7-(3-oxohexyl)purine-2,6-dione |
| SMILES | CCCCCCn1c(=O)c2c(ncn2CCC(=O)CCC)n(C2CC2)c1=O |
| InChI | InChI=1S/C20H30N4O3/c1-3-5-6-7-12-23-19(26)17-18(24(20(23)27)15-9-10-15)21-14-22(17)13-11-16(25)8-4-2/h14-15H,3-13H2,1-2H3 |
| InChIKey | LEDWAEIEKRJCIB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|