C22H36N4O7 — CID 18661185
7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-1,3-dihexylpurine-2,6-dione (PubChem CID 18661185) has the molecular formula C22H36N4O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is 7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-1,3-dihexylpurine-2,6-dione.
| Compound Name | 7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-1,3-dihexylpurine-2,6-dione |
|---|---|
| PubChem CID | 18661185 |
| Molecular Formula | C22H36N4O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-1,3-dihexylpurine-2,6-dione |
| SMILES | CCCCCCn1c(=O)c2c(ncn2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)n(CCCCCC)c1=O |
| InChI | InChI=1S/C22H36N4O7/c1-3-5-7-9-11-24-19-16(20(30)25(22(24)31)12-10-8-6-4-2)26(14-23-19)33-21-18(29)17(28)15(13-27)32-21/h14-15,17-18,21,27-29H,3-13H2,1-2H3/t15-,17-,18-,21+/m1/s1 |
| InChIKey | NFRMETPKPHQJSK-FLTJSSMESA-N |
| XLogP | 0.39 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|