C20H31N5O6 — CID 10478240
(2S,3S,4R,5R)-5-(1,3-dibutyl-2,6-dioxopurin-7-yl)-3,4-dihydroxy-N,N-dimethyloxolane-2-carboxamide (PubChem CID 10478240) has the molecular formula C20H31N5O6 and a molecular weight of 437.50 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-(1,3-dibutyl-2,6-dioxopurin-7-yl)-3,4-dihydroxy-N,N-dimethyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-(1,3-dibutyl-2,6-dioxopurin-7-yl)-3,4-dihydroxy-N,N-dimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 10478240 |
| Molecular Formula | C20H31N5O6 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (2S,3S,4R,5R)-5-(1,3-dibutyl-2,6-dioxopurin-7-yl)-3,4-dihydroxy-N,N-dimethyloxolane-2-carboxamide |
| SMILES | CCCCn1c(=O)c2c(ncn2[C@@H]2O[C@H](C(=O)N(C)C)[C@@H](O)[C@H]2O)n(CCCC)c1=O |
| InChI | InChI=1S/C20H31N5O6/c1-5-7-9-23-16-12(17(28)24(20(23)30)10-8-6-2)25(11-21-16)19-14(27)13(26)15(31-19)18(29)22(3)4/h11,13-15,19,26-27H,5-10H2,1-4H3/t13-,14+,15-,19+/m0/s1 |
| InChIKey | GQOMSVTXZFYGHP-QCUYGVNKSA-N |
| XLogP | -0.33 |
| TPSA | 131.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |