C12H14N2O — CID 82469664
3-[2-(5-methyl-1,3-oxazol-2-yl)ethyl]aniline (PubChem CID 82469664) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-[2-(5-methyl-1,3-oxazol-2-yl)ethyl]aniline.
| Compound Name | 3-[2-(5-methyl-1,3-oxazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 82469664 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-[2-(5-methyl-1,3-oxazol-2-yl)ethyl]aniline |
| SMILES | Cc1cnc(CCc2cccc(N)c2)o1 |
| InChI | InChI=1S/C12H14N2O/c1-9-8-14-12(15-9)6-5-10-3-2-4-11(13)7-10/h2-4,7-8H,5-6,13H2,1H3 |
| InChIKey | PFPRPEQZTRGHPV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|