C11H12N4 — CID 82469417
3-[2-(1,2,4-triazin-3-yl)ethyl]aniline (PubChem CID 82469417) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 3-[2-(1,2,4-triazin-3-yl)ethyl]aniline.
| Compound Name | 3-[2-(1,2,4-triazin-3-yl)ethyl]aniline |
|---|---|
| PubChem CID | 82469417 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3-[2-(1,2,4-triazin-3-yl)ethyl]aniline |
| SMILES | Nc1cccc(CCc2nccnn2)c1 |
| InChI | InChI=1S/C11H12N4/c12-10-3-1-2-9(8-10)4-5-11-13-6-7-14-15-11/h1-3,6-8H,4-5,12H2 |
| InChIKey | MXUXBIARGAHLBO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|